About [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate
[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate (PubChem CID 20634997) has the molecular formula C16H25F3O6SSi
and a molecular weight of 430.52 g/mol. Its IUPAC name is [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate |
| PubChem CID | 20634997 |
| Molecular Formula | C16H25F3O6SSi |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C(F)(F)F)cc(OC)c1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H25F3O6SSi/c1-15(2,3)27(6,7)24-10-12-13(22-4)8-11(9-14(12)23-5)25-26(20,21)16(17,18)19/h8-9H,10H2,1-7H3 |
| InChIKey | CJLSKXZPMQXULP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate?
The IUPAC name of [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate (CID 20634997) is [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate is COc1cc(OS(=O)(=O)C(F)(F)F)cc(OC)c1CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate?
The InChIKey is CJLSKXZPMQXULP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25F3O6SSi/c1-15(2,3)27(6,7)24-10-12-13(22-4)8-11(9-14(12)23-5)25-26(20,21)16(17,18)19/h8-9H,10H2,1-7H3.
What are the key properties of [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate?
[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate has a molecular weight of 430.52 g/mol, XLogP of 4.45, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,5-dimethoxyphenyl] trifluoromethanesulfonate is sourced from PubChem (CID 20634997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).