About 1H-1-benzazepine-7,8-diol
1H-1-benzazepine-7,8-diol (PubChem CID 20635031) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 1H-1-benzazepine-7,8-diol.
Molecular Properties
| Compound Name | 1H-1-benzazepine-7,8-diol |
| PubChem CID | 20635031 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 1H-1-benzazepine-7,8-diol |
| SMILES | Oc1cc2c(cc1O)NC=CC=C2 |
| InChI | InChI=1S/C10H9NO2/c12-9-5-7-3-1-2-4-11-8(7)6-10(9)13/h1-6,11-13H |
| InChIKey | VDEPOHIUUDOZLD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 1H-1-benzazepine-7,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-1-benzazepine-7,8-diol?
The IUPAC name of 1H-1-benzazepine-7,8-diol (CID 20635031) is 1H-1-benzazepine-7,8-diol.
What is the SMILES notation for 1H-1-benzazepine-7,8-diol?
The canonical SMILES for 1H-1-benzazepine-7,8-diol is Oc1cc2c(cc1O)NC=CC=C2.
What is the InChIKey of 1H-1-benzazepine-7,8-diol?
The InChIKey is VDEPOHIUUDOZLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c12-9-5-7-3-1-2-4-11-8(7)6-10(9)13/h1-6,11-13H.
What are the key properties of 1H-1-benzazepine-7,8-diol?
1H-1-benzazepine-7,8-diol has a molecular weight of 175.19 g/mol, XLogP of 2.05, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-1-benzazepine-7,8-diol is sourced from PubChem (CID 20635031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).