About 3,4-ditert-butyloxane
3,4-ditert-butyloxane (PubChem CID 20635135) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is 3,4-ditert-butyloxane.
Molecular Properties
| Compound Name | 3,4-ditert-butyloxane |
| PubChem CID | 20635135 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | 3,4-ditert-butyloxane |
| SMILES | CC(C)(C)C1CCOCC1C(C)(C)C |
| InChI | InChI=1S/C13H26O/c1-12(2,3)10-7-8-14-9-11(10)13(4,5)6/h10-11H,7-9H2,1-6H3 |
| InChIKey | PDCRURWYPNZVDS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-ditert-butyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-ditert-butyloxane?
The IUPAC name of 3,4-ditert-butyloxane (CID 20635135) is 3,4-ditert-butyloxane.
What is the SMILES notation for 3,4-ditert-butyloxane?
The canonical SMILES for 3,4-ditert-butyloxane is CC(C)(C)C1CCOCC1C(C)(C)C.
What is the InChIKey of 3,4-ditert-butyloxane?
The InChIKey is PDCRURWYPNZVDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O/c1-12(2,3)10-7-8-14-9-11(10)13(4,5)6/h10-11H,7-9H2,1-6H3.
What are the key properties of 3,4-ditert-butyloxane?
3,4-ditert-butyloxane has a molecular weight of 198.35 g/mol, XLogP of 3.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-ditert-butyloxane is sourced from PubChem (CID 20635135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).