C21H22N2O8S — CID 20636149
5-(2-ethoxyethyl)-5-[4-(4-methylsulfonylphenoxy)phenoxy]-1,3-diazinane-2,4,6-trione (PubChem CID 20636149) has the molecular formula C21H22N2O8S and a molecular weight of 462.48 g/mol. Its IUPAC name is 5-(2-ethoxyethyl)-5-[4-(4-methylsulfonylphenoxy)phenoxy]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2-ethoxyethyl)-5-[4-(4-methylsulfonylphenoxy)phenoxy]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 20636149 |
| Molecular Formula | C21H22N2O8S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 5-(2-ethoxyethyl)-5-[4-(4-methylsulfonylphenoxy)phenoxy]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOCCC1(Oc2ccc(Oc3ccc(S(C)(=O)=O)cc3)cc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C21H22N2O8S/c1-3-29-13-12-21(18(24)22-20(26)23-19(21)25)31-16-6-4-14(5-7-16)30-15-8-10-17(11-9-15)32(2,27)28/h4-11H,3,12-13H2,1-2H3,(H2,22,23,24,25,26) |
| InChIKey | SHISYUWYQPLRTA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|