C37H62O3SSi2 — CID 20636298
(4E,6Z)-7-[4-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]-3-ethylnona-4,6-dien-3-ol (PubChem CID 20636298) has the molecular formula C37H62O3SSi2 and a molecular weight of 643.14 g/mol. Its IUPAC name is (4E,6Z)-7-[4-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]-3-ethylnona-4,6-dien-3-ol.
| Compound Name | (4E,6Z)-7-[4-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]-3-ethylnona-4,6-dien-3-ol |
|---|---|
| PubChem CID | 20636298 |
| Molecular Formula | C37H62O3SSi2 |
| Molecular Weight | 643.14 g/mol |
| Exact Mass | 642.40 |
| IUPAC Name | (4E,6Z)-7-[4-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]-3-ethylnona-4,6-dien-3-ol |
| SMILES | CC/C(=C/C=C/C(O)(CC)CC)c1cc(CCc2ccc(CO[Si](C)(C)C(C)(C)C)c(CO[Si](C)(C)C(C)(C)C)c2)cs1 |
| InChI | InChI=1S/C37H62O3SSi2/c1-14-31(18-17-23-37(38,15-2)16-3)34-25-30(28-41-34)20-19-29-21-22-32(26-39-42(10,11)35(4,5)6)33(24-29)27-40-43(12,13)36(7,8)9/h17-18,21-25,28,38H,14-16,19-20,26-27H2,1-13H3/b23-17+,31-18- |
| InChIKey | TZVKPHRQDOPFJV-SQKHENCHSA-N |
| XLogP | 11.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.14 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|