C33H54O4SSi2 — CID 20636338
(Z)-5-[4-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]hept-4-enoic acid (PubChem CID 20636338) has the molecular formula C33H54O4SSi2 and a molecular weight of 603.03 g/mol. Its IUPAC name is (Z)-5-[4-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]hept-4-enoic acid.
| Compound Name | (Z)-5-[4-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]hept-4-enoic acid |
|---|---|
| PubChem CID | 20636338 |
| Molecular Formula | C33H54O4SSi2 |
| Molecular Weight | 603.03 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | (Z)-5-[4-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]hept-4-enoic acid |
| SMILES | CC/C(=C/CCC(=O)O)c1cc(CCc2ccc(CO[Si](C)(C)C(C)(C)C)c(CO[Si](C)(C)C(C)(C)C)c2)cs1 |
| InChI | InChI=1S/C33H54O4SSi2/c1-12-27(14-13-15-31(34)35)30-21-26(24-38-30)17-16-25-18-19-28(22-36-39(8,9)32(2,3)4)29(20-25)23-37-40(10,11)33(5,6)7/h14,18-21,24H,12-13,15-17,22-23H2,1-11H3,(H,34,35)/b27-14- |
| InChIKey | FDEZCDLJMLZYML-VYYCAZPPSA-N |
| XLogP | 10.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.03 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|