C34H48F6O4SSi2 — CID 20636350
(Z)-6-[5-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]thiophen-2-yl]-1,1,1-trifluoro-2-(trifluoromethyl)oct-5-en-3-yn-2-ol (PubChem CID 20636350) has the molecular formula C34H48F6O4SSi2 and a molecular weight of 722.98 g/mol. Its IUPAC name is (Z)-6-[5-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]thiophen-2-yl]-1,1,1-trifluoro-2-(trifluoromethyl)oct-5-en-3-yn-2-ol.
| Compound Name | (Z)-6-[5-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]thiophen-2-yl]-1,1,1-trifluoro-2-(trifluoromethyl)oct-5-en-3-yn-2-ol |
|---|---|
| PubChem CID | 20636350 |
| Molecular Formula | C34H48F6O4SSi2 |
| Molecular Weight | 722.98 g/mol |
| Exact Mass | 722.27 |
| IUPAC Name | (Z)-6-[5-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]thiophen-2-yl]-1,1,1-trifluoro-2-(trifluoromethyl)oct-5-en-3-yn-2-ol |
| SMILES | CC/C(=C/C#CC(O)(C(F)(F)F)C(F)(F)F)c1ccc(COc2ccc(CO[Si](C)(C)C(C)(C)C)c(CO[Si](C)(C)C(C)(C)C)c2)s1 |
| InChI | InChI=1S/C34H48F6O4SSi2/c1-12-24(14-13-19-32(41,33(35,36)37)34(38,39)40)29-18-17-28(45-29)23-42-27-16-15-25(21-43-46(8,9)30(2,3)4)26(20-27)22-44-47(10,11)31(5,6)7/h14-18,20,41H,12,21-23H2,1-11H3/b24-14- |
| InChIKey | RAULSOBEXWUDPK-OYKKKHCWSA-N |
| XLogP | 11.02 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.98 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|