C12H19N — CID 2063692
(2S,6S)-4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine (PubChem CID 2063692) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (2S,6S)-4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | (2S,6S)-4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 2063692 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2S,6S)-4-methyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine |
| SMILES | C=CC[C@H]1CC(C)=C[C@H](CC=C)N1 |
| InChI | InChI=1S/C12H19N/c1-4-6-11-8-10(3)9-12(13-11)7-5-2/h4-5,8,11-13H,1-2,6-7,9H2,3H3/t11-,12-/m0/s1 |
| InChIKey | BDKVHGIIDKMPBK-RYUDHWBXSA-N |
| XLogP | 2.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|