About diazenyl-(2,5-dioxopyrrol-1-yl)azanide
diazenyl-(2,5-dioxopyrrol-1-yl)azanide (PubChem CID 20637220) has the molecular formula C4H3N4O2-
and a molecular weight of 139.09 g/mol. Its IUPAC name is diazenyl-(2,5-dioxopyrrol-1-yl)azanide.
Molecular Properties
| Compound Name | diazenyl-(2,5-dioxopyrrol-1-yl)azanide |
| PubChem CID | 20637220 |
| Molecular Formula | C4H3N4O2- |
| Molecular Weight | 139.09 g/mol |
| Exact Mass | 139.03 |
| IUPAC Name | diazenyl-(2,5-dioxopyrrol-1-yl)azanide |
| SMILES | [H]/N=N/[N-]N1C(=O)C=CC1=O |
| InChI | InChI=1S/C4H3N4O2/c5-6-7-8-3(9)1-2-4(8)10/h1-2H,(H-,5,7)/q-1 |
| InChIKey | UOAVNLLDGUFVQP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.09 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze diazenyl-(2,5-dioxopyrrol-1-yl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazenyl-(2,5-dioxopyrrol-1-yl)azanide?
The IUPAC name of diazenyl-(2,5-dioxopyrrol-1-yl)azanide (CID 20637220) is diazenyl-(2,5-dioxopyrrol-1-yl)azanide.
What is the SMILES notation for diazenyl-(2,5-dioxopyrrol-1-yl)azanide?
The canonical SMILES for diazenyl-(2,5-dioxopyrrol-1-yl)azanide is [H]/N=N/[N-]N1C(=O)C=CC1=O.
What is the InChIKey of diazenyl-(2,5-dioxopyrrol-1-yl)azanide?
The InChIKey is UOAVNLLDGUFVQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3N4O2/c5-6-7-8-3(9)1-2-4(8)10/h1-2H,(H-,5,7)/q-1.
What are the key properties of diazenyl-(2,5-dioxopyrrol-1-yl)azanide?
diazenyl-(2,5-dioxopyrrol-1-yl)azanide has a molecular weight of 139.09 g/mol, XLogP of 0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazenyl-(2,5-dioxopyrrol-1-yl)azanide is sourced from PubChem (CID 20637220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).