C23H25N3O4 — CID 20637280
methyl 2-[1-benzyl-3-(C-carbamoyl-N-methylcarbonimidoyl)-2-ethylindol-4-yl]oxyacetate (PubChem CID 20637280) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl 2-[1-benzyl-3-(C-carbamoyl-N-methylcarbonimidoyl)-2-ethylindol-4-yl]oxyacetate.
| Compound Name | methyl 2-[1-benzyl-3-(C-carbamoyl-N-methylcarbonimidoyl)-2-ethylindol-4-yl]oxyacetate |
|---|---|
| PubChem CID | 20637280 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | methyl 2-[1-benzyl-3-(C-carbamoyl-N-methylcarbonimidoyl)-2-ethylindol-4-yl]oxyacetate |
| SMILES | CCc1c(/C(=N/C)C(N)=O)c2c(OCC(=O)OC)cccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C23H25N3O4/c1-4-16-21(22(25-2)23(24)28)20-17(26(16)13-15-9-6-5-7-10-15)11-8-12-18(20)30-14-19(27)29-3/h5-12H,4,13-14H2,1-3H3,(H2,24,28)/b25-22- |
| InChIKey | IUQDBJPEHZTQEA-LVWGJNHUSA-N |
| XLogP | 2.71 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|