C37H33F7N2 — CID 20637521
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-[(6-naphthalen-1-yl-2-pyridinyl)-phenylmethyl]-2,6-di(propan-2-yl)aniline (PubChem CID 20637521) has the molecular formula C37H33F7N2 and a molecular weight of 638.67 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-[(6-naphthalen-1-yl-2-pyridinyl)-phenylmethyl]-2,6-di(propan-2-yl)aniline.
| Compound Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-[(6-naphthalen-1-yl-2-pyridinyl)-phenylmethyl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 20637521 |
| Molecular Formula | C37H33F7N2 |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-[(6-naphthalen-1-yl-2-pyridinyl)-phenylmethyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C(C)C)c1NC(c1ccccc1)c1cccc(-c2cccc3ccccc23)n1 |
| InChI | InChI=1S/C37H33F7N2/c1-22(2)29-20-26(35(38,36(39,40)41)37(42,43)44)21-30(23(3)4)34(29)46-33(25-13-6-5-7-14-25)32-19-11-18-31(45-32)28-17-10-15-24-12-8-9-16-27(24)28/h5-23,33,46H,1-4H3 |
| InChIKey | GXDUCDGTURDHPG-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |