C13H18O6 — CID 20637640
(4S,5S)-2-(6-methylhepta-1,5-dien-2-yl)-1,3-dioxolane-4,5-dicarboxylic acid (PubChem CID 20637640) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is (4S,5S)-2-(6-methylhepta-1,5-dien-2-yl)-1,3-dioxolane-4,5-dicarboxylic acid.
| Compound Name | (4S,5S)-2-(6-methylhepta-1,5-dien-2-yl)-1,3-dioxolane-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 20637640 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (4S,5S)-2-(6-methylhepta-1,5-dien-2-yl)-1,3-dioxolane-4,5-dicarboxylic acid |
| SMILES | C=C(CCC=C(C)C)C1O[C@H](C(=O)O)[C@@H](C(=O)O)O1 |
| InChI | InChI=1S/C13H18O6/c1-7(2)5-4-6-8(3)13-18-9(11(14)15)10(19-13)12(16)17/h5,9-10,13H,3-4,6H2,1-2H3,(H,14,15)(H,16,17)/t9-,10-/m0/s1 |
| InChIKey | UZDLKCKIQXJYJA-UWVGGRQHSA-N |
| XLogP | 1.57 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|