C30H36F4O3 — CID 20638167
(3,4,5-trifluorophenyl) 4-[[4-(1-butylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate (PubChem CID 20638167) has the molecular formula C30H36F4O3 and a molecular weight of 520.61 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 4-[[4-(1-butylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate.
| Compound Name | (3,4,5-trifluorophenyl) 4-[[4-(1-butylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate |
|---|---|
| PubChem CID | 20638167 |
| Molecular Formula | C30H36F4O3 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (3,4,5-trifluorophenyl) 4-[[4-(1-butylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate |
| SMILES | CCCCC1(C2CCC(COc3ccc(C(=O)Oc4cc(F)c(F)c(F)c4)c(F)c3)CC2)CCCCC1 |
| InChI | InChI=1S/C30H36F4O3/c1-2-3-13-30(14-5-4-6-15-30)21-9-7-20(8-10-21)19-36-22-11-12-24(25(31)16-22)29(35)37-23-17-26(32)28(34)27(33)18-23/h11-12,16-18,20-21H,2-10,13-15,19H2,1H3 |
| InChIKey | QVKIEOCUFIFZKQ-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|