About (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate
(3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate (PubChem CID 20638168) has the molecular formula C28H32F4O3
and a molecular weight of 492.55 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate.
Molecular Properties
| Compound Name | (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate |
| PubChem CID | 20638168 |
| Molecular Formula | C28H32F4O3 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate |
| SMILES | CCC1CCC(C2CCC(COc3ccc(C(=O)Oc4cc(F)c(F)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C28H32F4O3/c1-2-17-3-7-19(8-4-17)20-9-5-18(6-10-20)16-34-21-11-12-23(24(29)13-21)28(33)35-22-14-25(30)27(32)26(31)15-22/h11-15,17-20H,2-10,16H2,1H3 |
| InChIKey | VGPQSRWLIUHDDO-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate?
The IUPAC name of (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate (CID 20638168) is (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate.
What is the SMILES notation for (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate?
The canonical SMILES for (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate is CCC1CCC(C2CCC(COc3ccc(C(=O)Oc4cc(F)c(F)c(F)c4)c(F)c3)CC2)CC1.
What is the InChIKey of (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate?
The InChIKey is VGPQSRWLIUHDDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H32F4O3/c1-2-17-3-7-19(8-4-17)20-9-5-18(6-10-20)16-34-21-11-12-23(24(29)13-21)28(33)35-22-14-25(30)27(32)26(31)15-22/h11-15,17-20H,2-10,16H2,1H3.
What are the key properties of (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate?
(3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate has a molecular weight of 492.55 g/mol, XLogP of 7.86, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,5-trifluorophenyl) 4-[[4-(4-ethylcyclohexyl)cyclohexyl]methoxy]-2-fluorobenzoate is sourced from PubChem (CID 20638168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).