C31H38F4O3 — CID 20638169
(3,4,5-trifluorophenyl) 2-fluoro-4-[[4-(1-pentan-2-ylcyclohexyl)cyclohexyl]methoxy]benzoate (PubChem CID 20638169) has the molecular formula C31H38F4O3 and a molecular weight of 534.63 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl) 2-fluoro-4-[[4-(1-pentan-2-ylcyclohexyl)cyclohexyl]methoxy]benzoate.
| Compound Name | (3,4,5-trifluorophenyl) 2-fluoro-4-[[4-(1-pentan-2-ylcyclohexyl)cyclohexyl]methoxy]benzoate |
|---|---|
| PubChem CID | 20638169 |
| Molecular Formula | C31H38F4O3 |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | (3,4,5-trifluorophenyl) 2-fluoro-4-[[4-(1-pentan-2-ylcyclohexyl)cyclohexyl]methoxy]benzoate |
| SMILES | CCCC(C)C1(C2CCC(COc3ccc(C(=O)Oc4cc(F)c(F)c(F)c4)c(F)c3)CC2)CCCCC1 |
| InChI | InChI=1S/C31H38F4O3/c1-3-7-20(2)31(14-5-4-6-15-31)22-10-8-21(9-11-22)19-37-23-12-13-25(26(32)16-23)30(36)38-24-17-27(33)29(35)28(34)18-24/h12-13,16-18,20-22H,3-11,14-15,19H2,1-2H3 |
| InChIKey | VYYFEIMDBKQRPR-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|