C27H26N2O7 — CID 20638249
[(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 2-(2-nitrophenyl)acetate (PubChem CID 20638249) has the molecular formula C27H26N2O7 and a molecular weight of 490.51 g/mol. Its IUPAC name is [(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 2-(2-nitrophenyl)acetate.
| Compound Name | [(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 2-(2-nitrophenyl)acetate |
|---|---|
| PubChem CID | 20638249 |
| Molecular Formula | C27H26N2O7 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | [(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 2-(2-nitrophenyl)acetate |
| SMILES | CC(=O)Oc1ccc2c3c1O[C@H]1[C@@H](OC(=O)Cc4ccccc4[N+](=O)[O-])C=C[C@H]4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C27H26N2O7/c1-15(30)34-21-9-7-17-13-20-18-8-10-22(26-27(18,11-12-28(20)2)24(17)25(21)36-26)35-23(31)14-16-5-3-4-6-19(16)29(32)33/h3-10,18,20,22,26H,11-14H2,1-2H3/t18-,20+,22-,26-,27-/m0/s1 |
| InChIKey | UOPNNKURJKFBDK-CXKJJBRUSA-N |
| XLogP | 3.12 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|