C16H27N7O2S — CID 20638505
(1S,2R,3S,5R)-3-amino-5-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol (PubChem CID 20638505) has the molecular formula C16H27N7O2S and a molecular weight of 381.51 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-amino-5-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-amino-5-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 20638505 |
| Molecular Formula | C16H27N7O2S |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (1S,2R,3S,5R)-3-amino-5-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]cyclopentane-1,2-diol |
| SMILES | CCCCNc1nc(SCCC)nc2c1nnn2[C@@H]1C[C@H](N)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H27N7O2S/c1-3-5-6-18-14-11-15(20-16(19-14)26-7-4-2)23(22-21-11)10-8-9(17)12(24)13(10)25/h9-10,12-13,24-25H,3-8,17H2,1-2H3,(H,18,19,20)/t9-,10+,12+,13-/m0/s1 |
| InChIKey | NYSLDXRDFXCTAL-YGNMPJRFSA-N |
| XLogP | 0.93 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|