C26H29NO — CID 20638560
(1R)-1-[6-(dibenzylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]ethanol (PubChem CID 20638560) has the molecular formula C26H29NO and a molecular weight of 371.52 g/mol. Its IUPAC name is (1R)-1-[6-(dibenzylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]ethanol.
| Compound Name | (1R)-1-[6-(dibenzylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]ethanol |
|---|---|
| PubChem CID | 20638560 |
| Molecular Formula | C26H29NO |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (1R)-1-[6-(dibenzylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]ethanol |
| SMILES | C[C@@H](O)c1cccc2c1CCC(N(Cc1ccccc1)Cc1ccccc1)C2 |
| InChI | InChI=1S/C26H29NO/c1-20(28)25-14-8-13-23-17-24(15-16-26(23)25)27(18-21-9-4-2-5-10-21)19-22-11-6-3-7-12-22/h2-14,20,24,28H,15-19H2,1H3/t20-,24?/m1/s1 |
| InChIKey | ZFLGBSLADDTQKP-CGHJUBPDSA-N |
| XLogP | 5.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |