C17H28N6O3S — CID 20638786
(1R,2S,3R,5R)-3-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 20638786) has the molecular formula C17H28N6O3S and a molecular weight of 396.52 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 20638786 |
| Molecular Formula | C17H28N6O3S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (1R,2S,3R,5R)-3-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | CCCCNc1nc(SCCC)nc2c1nnn2[C@@H]1C[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H28N6O3S/c1-3-5-6-18-15-12-16(20-17(19-15)27-7-4-2)23(22-21-12)11-8-10(9-24)13(25)14(11)26/h10-11,13-14,24-26H,3-9H2,1-2H3,(H,18,19,20)/t10-,11-,13-,14+/m1/s1 |
| InChIKey | VEJDIHYHYBKHNO-OXHZDVMGSA-N |
| XLogP | 1.21 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|