C17H29N3O4S — CID 20638913
6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]hexanoic acid (PubChem CID 20638913) has the molecular formula C17H29N3O4S and a molecular weight of 371.50 g/mol. Its IUPAC name is 6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]hexanoic acid.
| Compound Name | 6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]hexanoic acid |
|---|---|
| PubChem CID | 20638913 |
| Molecular Formula | C17H29N3O4S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]hexanoic acid |
| SMILES | CN(CCCCCC(=O)O)C(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C17H29N3O4S/c1-20(10-6-2-3-9-15(22)23)14(21)8-5-4-7-13-16-12(11-25-13)18-17(24)19-16/h12-13,16H,2-11H2,1H3,(H,22,23)(H2,18,19,24)/t12-,13-,16-/m0/s1 |
| InChIKey | GUFJTCTUJFIGDF-XEZPLFJOSA-N |
| XLogP | 1.82 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|