C22H28 — CID 20638990
1-(4-butylcyclohexyl)-4-phenylbenzene (PubChem CID 20638990) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-(4-butylcyclohexyl)-4-phenylbenzene.
| Compound Name | 1-(4-butylcyclohexyl)-4-phenylbenzene |
|---|---|
| PubChem CID | 20638990 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-(4-butylcyclohexyl)-4-phenylbenzene |
| SMILES | CCCCC1CCC(c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C22H28/c1-2-3-7-18-10-12-20(13-11-18)22-16-14-21(15-17-22)19-8-5-4-6-9-19/h4-6,8-9,14-18,20H,2-3,7,10-13H2,1H3 |
| InChIKey | GNOASZZLPQGQQA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |