C27H27F4N3O6 — CID 20639701
3-[[(2S)-2-[(1,3-dimethylindole-2-carbonyl)amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 20639701) has the molecular formula C27H27F4N3O6 and a molecular weight of 565.52 g/mol. Its IUPAC name is 3-[[(2S)-2-[(1,3-dimethylindole-2-carbonyl)amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | 3-[[(2S)-2-[(1,3-dimethylindole-2-carbonyl)amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 20639701 |
| Molecular Formula | C27H27F4N3O6 |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 3-[[(2S)-2-[(1,3-dimethylindole-2-carbonyl)amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | Cc1c(C(=O)N[C@H](C(=O)NC(CC(=O)O)C(=O)COc2c(F)c(F)cc(F)c2F)C(C)C)n(C)c2ccccc12 |
| InChI | InChI=1S/C27H27F4N3O6/c1-12(2)23(33-27(39)24-13(3)14-7-5-6-8-18(14)34(24)4)26(38)32-17(10-20(36)37)19(35)11-40-25-21(30)15(28)9-16(29)22(25)31/h5-9,12,17,23H,10-11H2,1-4H3,(H,32,38)(H,33,39)(H,36,37)/t17?,23-/m0/s1 |
| InChIKey | OZEKTCCOEMJUFK-VXLWULRPSA-N |
| XLogP | 3.41 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|