C14H31N3O4 — CID 20640242
(2S)-2-amino-2,4-dimethylpentanoic acid;(2S)-2,6-diamino-2-methylhexanoic acid (PubChem CID 20640242) has the molecular formula C14H31N3O4 and a molecular weight of 305.42 g/mol. Its IUPAC name is (2S)-2-amino-2,4-dimethylpentanoic acid;(2S)-2,6-diamino-2-methylhexanoic acid.
| Compound Name | (2S)-2-amino-2,4-dimethylpentanoic acid;(2S)-2,6-diamino-2-methylhexanoic acid |
|---|---|
| PubChem CID | 20640242 |
| Molecular Formula | C14H31N3O4 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | (2S)-2-amino-2,4-dimethylpentanoic acid;(2S)-2,6-diamino-2-methylhexanoic acid |
| SMILES | CC(C)C[C@](C)(N)C(=O)O.C[C@](N)(CCCCN)C(=O)O |
| InChI | InChI=1S/C7H16N2O2.C7H15NO2/c1-7(9,6(10)11)4-2-3-5-8;1-5(2)4-7(3,8)6(9)10/h2-5,8-9H2,1H3,(H,10,11);5H,4,8H2,1-3H3,(H,9,10)/t2*7-/m00/s1 |
| InChIKey | CLPICHCQFCXGQA-VGMFFHCQSA-N |
| XLogP | 0.75 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|