About (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid
(2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid (PubChem CID 20640243) has the molecular formula C13H28N2O4S
and a molecular weight of 308.44 g/mol. Its IUPAC name is (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid |
| PubChem CID | 20640243 |
| Molecular Formula | C13H28N2O4S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid |
| SMILES | CCCC[C@](C)(N)C(=O)O.CSCC[C@](C)(N)C(=O)O |
| InChI | InChI=1S/C7H15NO2.C6H13NO2S/c1-3-4-5-7(2,8)6(9)10;1-6(7,5(8)9)3-4-10-2/h3-5,8H2,1-2H3,(H,9,10);3-4,7H2,1-2H3,(H,8,9)/t7-;6-/m00/s1 |
| InChIKey | QOEDGKNTTLWFTB-KSTOEEEWSA-N |
| XLogP | 1.52 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid?
The IUPAC name of (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid (CID 20640243) is (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid.
What is the SMILES notation for (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid?
The canonical SMILES for (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid is CCCC[C@](C)(N)C(=O)O.CSCC[C@](C)(N)C(=O)O.
What is the InChIKey of (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid?
The InChIKey is QOEDGKNTTLWFTB-KSTOEEEWSA-N. The full InChI is InChI=1S/C7H15NO2.C6H13NO2S/c1-3-4-5-7(2,8)6(9)10;1-6(7,5(8)9)3-4-10-2/h3-5,8H2,1-2H3,(H,9,10);3-4,7H2,1-2H3,(H,8,9)/t7-;6-/m00/s1.
What are the key properties of (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid?
(2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid has a molecular weight of 308.44 g/mol, XLogP of 1.52, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2-methylhexanoic acid;(2S)-2-amino-2-methyl-4-methylsulfanylbutanoic acid is sourced from PubChem (CID 20640243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).