C17H28O2 — CID 20640365
(4E,11E)-15-hydroxy-3,13-dimethylcyclopentadeca-4,11-dien-1-one (PubChem CID 20640365) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (4E,11E)-15-hydroxy-3,13-dimethylcyclopentadeca-4,11-dien-1-one.
| Compound Name | (4E,11E)-15-hydroxy-3,13-dimethylcyclopentadeca-4,11-dien-1-one |
|---|---|
| PubChem CID | 20640365 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (4E,11E)-15-hydroxy-3,13-dimethylcyclopentadeca-4,11-dien-1-one |
| SMILES | CC1/C=C/CCCCC/C=C/C(C)CC(O)C(=O)C1 |
| InChI | InChI=1S/C17H28O2/c1-14-10-8-6-4-3-5-7-9-11-15(2)13-17(19)16(18)12-14/h8-11,14-16,18H,3-7,12-13H2,1-2H3/b10-8+,11-9+ |
| InChIKey | VSRDCPRFCKLFDU-GFULKKFKSA-N |
| XLogP | 4.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|