About (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one
(4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one (PubChem CID 20640366) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one.
Molecular Properties
| Compound Name | (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one |
| PubChem CID | 20640366 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one |
| SMILES | CC1CC/C=C/CCC(=O)C(O)CC/C=C/CC1 |
| InChI | InChI=1S/C16H26O2/c1-14-10-6-2-4-8-12-15(17)16(18)13-9-5-3-7-11-14/h2-5,14-15,17H,6-13H2,1H3/b4-2+,5-3+ |
| InChIKey | RXBDRACJGLYQDA-ZUVMSYQZSA-N |
| XLogP | 3.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one?
The IUPAC name of (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one (CID 20640366) is (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one.
What is the SMILES notation for (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one?
The canonical SMILES for (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one is CC1CC/C=C/CCC(=O)C(O)CC/C=C/CC1.
What is the InChIKey of (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one?
The InChIKey is RXBDRACJGLYQDA-ZUVMSYQZSA-N. The full InChI is InChI=1S/C16H26O2/c1-14-10-6-2-4-8-12-15(17)16(18)13-9-5-3-7-11-14/h2-5,14-15,17H,6-13H2,1H3/b4-2+,5-3+.
What are the key properties of (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one?
(4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one has a molecular weight of 250.38 g/mol, XLogP of 3.80, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,11E)-15-hydroxy-8-methylcyclopentadeca-4,11-dien-1-one is sourced from PubChem (CID 20640366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).