C18H30O2 — CID 20640368
(4E,12E)-16-hydroxy-3,14-dimethylcyclohexadeca-4,12-dien-1-one (PubChem CID 20640368) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (4E,12E)-16-hydroxy-3,14-dimethylcyclohexadeca-4,12-dien-1-one.
| Compound Name | (4E,12E)-16-hydroxy-3,14-dimethylcyclohexadeca-4,12-dien-1-one |
|---|---|
| PubChem CID | 20640368 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (4E,12E)-16-hydroxy-3,14-dimethylcyclohexadeca-4,12-dien-1-one |
| SMILES | CC1/C=C/CCCCCC/C=C/C(C)CC(O)C(=O)C1 |
| InChI | InChI=1S/C18H30O2/c1-15-11-9-7-5-3-4-6-8-10-12-16(2)14-18(20)17(19)13-15/h9-12,15-17,19H,3-8,13-14H2,1-2H3/b11-9+,12-10+ |
| InChIKey | PSNGUFZXVUBQRW-WGDLNXRISA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|