C33H41N5O2 — CID 20640391
(2R,5S)-1-benzyl-4-[(R)-[4-[2-(2-ethoxyethyl)-1,2,4-triazol-3-yl]phenyl]-(3-methoxyphenyl)methyl]-2,5-dimethylpiperazine (PubChem CID 20640391) has the molecular formula C33H41N5O2 and a molecular weight of 539.72 g/mol. Its IUPAC name is (2R,5S)-1-benzyl-4-[(R)-[4-[2-(2-ethoxyethyl)-1,2,4-triazol-3-yl]phenyl]-(3-methoxyphenyl)methyl]-2,5-dimethylpiperazine.
| Compound Name | (2R,5S)-1-benzyl-4-[(R)-[4-[2-(2-ethoxyethyl)-1,2,4-triazol-3-yl]phenyl]-(3-methoxyphenyl)methyl]-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 20640391 |
| Molecular Formula | C33H41N5O2 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.33 |
| IUPAC Name | (2R,5S)-1-benzyl-4-[(R)-[4-[2-(2-ethoxyethyl)-1,2,4-triazol-3-yl]phenyl]-(3-methoxyphenyl)methyl]-2,5-dimethylpiperazine |
| SMILES | CCOCCn1ncnc1-c1ccc([C@H](c2cccc(OC)c2)N2C[C@@H](C)N(Cc3ccccc3)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C33H41N5O2/c1-5-40-19-18-38-33(34-24-35-38)29-16-14-28(15-17-29)32(30-12-9-13-31(20-30)39-4)37-22-25(2)36(21-26(37)3)23-27-10-7-6-8-11-27/h6-17,20,24-26,32H,5,18-19,21-23H2,1-4H3/t25-,26+,32-/m1/s1 |
| InChIKey | MDDVCEAWAGUGGM-SZZWIKJPSA-N |
| XLogP | 5.67 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|