C11H11Cl2NO3 — CID 20640800
methyl (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoate (PubChem CID 20640800) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is methyl (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoate.
| Compound Name | methyl (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 20640800 |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | methyl (2R)-2-amino-4-(3,4-dichlorophenyl)-4-oxobutanoate |
| SMILES | COC(=O)[C@H](N)CC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO3/c1-17-11(16)9(14)5-10(15)6-2-3-7(12)8(13)4-6/h2-4,9H,5,14H2,1H3/t9-/m1/s1 |
| InChIKey | YTPAAFAUNSLSJY-SECBINFHSA-N |
| XLogP | 2.07 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |