About (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid
(2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid (PubChem CID 20640807) has the molecular formula C11H11Cl2NO5S
and a molecular weight of 340.18 g/mol. Its IUPAC name is (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid.
Molecular Properties
| Compound Name | (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid |
| PubChem CID | 20640807 |
| Molecular Formula | C11H11Cl2NO5S |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid |
| SMILES | CS(=O)(=O)N[C@H](CC(=O)c1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C11H11Cl2NO5S/c1-20(18,19)14-9(11(16)17)5-10(15)6-2-3-7(12)8(13)4-6/h2-4,9,14H,5H2,1H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | WJURXNMOMXNBHC-SECBINFHSA-N |
| XLogP | 1.57 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid?
The IUPAC name of (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid (CID 20640807) is (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid.
What is the SMILES notation for (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid?
The canonical SMILES for (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid is CS(=O)(=O)N[C@H](CC(=O)c1ccc(Cl)c(Cl)c1)C(=O)O.
What is the InChIKey of (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid?
The InChIKey is WJURXNMOMXNBHC-SECBINFHSA-N. The full InChI is InChI=1S/C11H11Cl2NO5S/c1-20(18,19)14-9(11(16)17)5-10(15)6-2-3-7(12)8(13)4-6/h2-4,9,14H,5H2,1H3,(H,16,17)/t9-/m1/s1.
What are the key properties of (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid?
(2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid has a molecular weight of 340.18 g/mol, XLogP of 1.57, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-(3,4-dichlorophenyl)-2-(methanesulfonamido)-4-oxobutanoic acid is sourced from PubChem (CID 20640807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).