C35H21F3N4O — CID 20641036
(E)-N-carbazol-9-yl-1-[5-[(E)-carbazol-9-yliminomethyl]-1-benzofuran-2-yl]-2,2,2-trifluoroethanimine (PubChem CID 20641036) has the molecular formula C35H21F3N4O and a molecular weight of 570.57 g/mol. Its IUPAC name is (E)-N-carbazol-9-yl-1-[5-[(E)-carbazol-9-yliminomethyl]-1-benzofuran-2-yl]-2,2,2-trifluoroethanimine.
| Compound Name | (E)-N-carbazol-9-yl-1-[5-[(E)-carbazol-9-yliminomethyl]-1-benzofuran-2-yl]-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 20641036 |
| Molecular Formula | C35H21F3N4O |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | (E)-N-carbazol-9-yl-1-[5-[(E)-carbazol-9-yliminomethyl]-1-benzofuran-2-yl]-2,2,2-trifluoroethanimine |
| SMILES | FC(F)(F)/C(=N\n1c2ccccc2c2ccccc21)c1cc2cc(/C=N/n3c4ccccc4c4ccccc43)ccc2o1 |
| InChI | InChI=1S/C35H21F3N4O/c36-35(37,38)34(40-42-30-15-7-3-11-26(30)27-12-4-8-16-31(27)42)33-20-23-19-22(17-18-32(23)43-33)21-39-41-28-13-5-1-9-24(28)25-10-2-6-14-29(25)41/h1-21H/b39-21+,40-34- |
| InChIKey | NTHVWDWJMIHFJQ-HNOMXKGISA-N |
| XLogP | 9.35 |
| TPSA | 47.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|