About americium;bis(2-methanidyl-2-methylbutane)
americium;bis(2-methanidyl-2-methylbutane) (PubChem CID 20641101) has the molecular formula C12H26Am-2
and a molecular weight of 413.34 g/mol. Its IUPAC name is americium;bis(2-methanidyl-2-methylbutane).
Molecular Properties
| Compound Name | americium;bis(2-methanidyl-2-methylbutane) |
| PubChem CID | 20641101 |
| Molecular Formula | C12H26Am-2 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | americium;bis(2-methanidyl-2-methylbutane) |
| SMILES | [Am].[CH2-]C(C)(C)CC.[CH2-]C(C)(C)CC |
| InChI | InChI=1S/2C6H13.Am/c2*1-5-6(2,3)4;/h2*2,5H2,1,3-4H3;/q2*-1; |
| InChIKey | DACTYADPUVSQFX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze americium;bis(2-methanidyl-2-methylbutane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of americium;bis(2-methanidyl-2-methylbutane)?
The IUPAC name of americium;bis(2-methanidyl-2-methylbutane) (CID 20641101) is americium;bis(2-methanidyl-2-methylbutane).
What is the SMILES notation for americium;bis(2-methanidyl-2-methylbutane)?
The canonical SMILES for americium;bis(2-methanidyl-2-methylbutane) is [Am].[CH2-]C(C)(C)CC.[CH2-]C(C)(C)CC.
What is the InChIKey of americium;bis(2-methanidyl-2-methylbutane)?
The InChIKey is DACTYADPUVSQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H13.Am/c2*1-5-6(2,3)4;/h2*2,5H2,1,3-4H3;/q2*-1;.
What are the key properties of americium;bis(2-methanidyl-2-methylbutane)?
americium;bis(2-methanidyl-2-methylbutane) has a molecular weight of 413.34 g/mol, XLogP of 4.51, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for americium;bis(2-methanidyl-2-methylbutane) is sourced from PubChem (CID 20641101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).