C9H19N5O — CID 20641631
2-[2-[4-(methylamino)piperidin-1-yl]-2-oxoethyl]guanidine (PubChem CID 20641631) has the molecular formula C9H19N5O and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[2-[4-(methylamino)piperidin-1-yl]-2-oxoethyl]guanidine.
| Compound Name | 2-[2-[4-(methylamino)piperidin-1-yl]-2-oxoethyl]guanidine |
|---|---|
| PubChem CID | 20641631 |
| Molecular Formula | C9H19N5O |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 2-[2-[4-(methylamino)piperidin-1-yl]-2-oxoethyl]guanidine |
| SMILES | CNC1CCN(C(=O)CN=C(N)N)CC1 |
| InChI | InChI=1S/C9H19N5O/c1-12-7-2-4-14(5-3-7)8(15)6-13-9(10)11/h7,12H,2-6H2,1H3,(H4,10,11,13) |
| InChIKey | DDXCKCUURUWFDL-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|