About 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one
3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one (PubChem CID 20641814) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one |
| PubChem CID | 20641814 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one |
| SMILES | CC1(CCC2CCNC2=O)OCCO1 |
| InChI | InChI=1S/C10H17NO3/c1-10(13-6-7-14-10)4-2-8-3-5-11-9(8)12/h8H,2-7H2,1H3,(H,11,12) |
| InChIKey | LGXIWEUQPZZLDN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one?
The IUPAC name of 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one (CID 20641814) is 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one.
What is the SMILES notation for 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one?
The canonical SMILES for 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one is CC1(CCC2CCNC2=O)OCCO1.
What is the InChIKey of 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one?
The InChIKey is LGXIWEUQPZZLDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-10(13-6-7-14-10)4-2-8-3-5-11-9(8)12/h8H,2-7H2,1H3,(H,11,12).
What are the key properties of 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one?
3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one has a molecular weight of 199.25 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]pyrrolidin-2-one is sourced from PubChem (CID 20641814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).