About methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium
methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium (PubChem CID 20642012) has the molecular formula C10H10F3N3O4Y
and a molecular weight of 382.11 g/mol. Its IUPAC name is methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium.
Molecular Properties
| Compound Name | methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium |
| PubChem CID | 20642012 |
| Molecular Formula | C10H10F3N3O4Y |
| Molecular Weight | 382.11 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium |
| SMILES | CO/N=C(/C(=O)OC)c1cnc(C(F)(F)F)nc1CO.[Y] |
| InChI | InChI=1S/C10H10F3N3O4.Y/c1-19-8(18)7(16-20-2)5-3-14-9(10(11,12)13)15-6(5)4-17;/h3,17H,4H2,1-2H3;/b16-7+; |
| InChIKey | DJYHEKABUSHADH-OYXUYBEVSA-N |
| XLogP | 0.51 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.11 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium?
The IUPAC name of methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium (CID 20642012) is methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium.
What is the SMILES notation for methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium?
The canonical SMILES for methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium is CO/N=C(/C(=O)OC)c1cnc(C(F)(F)F)nc1CO.[Y].
What is the InChIKey of methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium?
The InChIKey is DJYHEKABUSHADH-OYXUYBEVSA-N. The full InChI is InChI=1S/C10H10F3N3O4.Y/c1-19-8(18)7(16-20-2)5-3-14-9(10(11,12)13)15-6(5)4-17;/h3,17H,4H2,1-2H3;/b16-7+;.
What are the key properties of methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium?
methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium has a molecular weight of 382.11 g/mol, XLogP of 0.51, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2E)-2-[4-(hydroxymethyl)-2-(trifluoromethyl)pyrimidin-5-yl]-2-methoxyiminoacetate;yttrium is sourced from PubChem (CID 20642012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).