About 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one
9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one (PubChem CID 20642530) has the molecular formula C15H11FO3S
and a molecular weight of 290.32 g/mol. Its IUPAC name is 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one.
Molecular Properties
| Compound Name | 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one |
| PubChem CID | 20642530 |
| Molecular Formula | C15H11FO3S |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one |
| SMILES | Cc1ccc2c(c1)S(=O)(=O)Cc1ccc(F)cc1C2=O |
| InChI | InChI=1S/C15H11FO3S/c1-9-2-5-12-14(6-9)20(18,19)8-10-3-4-11(16)7-13(10)15(12)17/h2-7H,8H2,1H3 |
| InChIKey | OFENJUBHVVCNEI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one?
The IUPAC name of 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one (CID 20642530) is 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one.
What is the SMILES notation for 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one?
The canonical SMILES for 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one is Cc1ccc2c(c1)S(=O)(=O)Cc1ccc(F)cc1C2=O.
What is the InChIKey of 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one?
The InChIKey is OFENJUBHVVCNEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FO3S/c1-9-2-5-12-14(6-9)20(18,19)8-10-3-4-11(16)7-13(10)15(12)17/h2-7H,8H2,1H3.
What are the key properties of 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one?
9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one has a molecular weight of 290.32 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-3-methyl-5,5-dioxo-6H-benzo[c][1]benzothiepin-11-one is sourced from PubChem (CID 20642530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).