About 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol
3-amino-1,1-bis(3-fluorophenyl)propan-1-ol (PubChem CID 20642702) has the molecular formula C15H15F2NO
and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol.
Molecular Properties
| Compound Name | 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol |
| PubChem CID | 20642702 |
| Molecular Formula | C15H15F2NO |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol |
| SMILES | NCCC(O)(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C15H15F2NO/c16-13-5-1-3-11(9-13)15(19,7-8-18)12-4-2-6-14(17)10-12/h1-6,9-10,19H,7-8,18H2 |
| InChIKey | BJGRCZRHDYWVSY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol?
The IUPAC name of 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol (CID 20642702) is 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol.
What is the SMILES notation for 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol?
The canonical SMILES for 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol is NCCC(O)(c1cccc(F)c1)c1cccc(F)c1.
What is the InChIKey of 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol?
The InChIKey is BJGRCZRHDYWVSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F2NO/c16-13-5-1-3-11(9-13)15(19,7-8-18)12-4-2-6-14(17)10-12/h1-6,9-10,19H,7-8,18H2.
What are the key properties of 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol?
3-amino-1,1-bis(3-fluorophenyl)propan-1-ol has a molecular weight of 263.29 g/mol, XLogP of 2.55, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,1-bis(3-fluorophenyl)propan-1-ol is sourced from PubChem (CID 20642702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).