C18H18F2 — CID 20642739
7,12-difluoro-2-propyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 20642739) has the molecular formula C18H18F2 and a molecular weight of 272.34 g/mol. Its IUPAC name is 7,12-difluoro-2-propyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 7,12-difluoro-2-propyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 20642739 |
| Molecular Formula | C18H18F2 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 7,12-difluoro-2-propyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | CCCC1c2cccc(F)c2CCc2c(F)cccc21 |
| InChI | InChI=1S/C18H18F2/c1-2-5-12-13-6-3-8-17(19)15(13)10-11-16-14(12)7-4-9-18(16)20/h3-4,6-9,12H,2,5,10-11H2,1H3 |
| InChIKey | QESLUKPPFNWUBY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |