About [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide
[1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide (PubChem CID 20643132) has the molecular formula C10H11ClN4S
and a molecular weight of 254.75 g/mol. Its IUPAC name is [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide.
Molecular Properties
| Compound Name | [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide |
| PubChem CID | 20643132 |
| Molecular Formula | C10H11ClN4S |
| Molecular Weight | 254.75 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide |
| SMILES | N#C/N=C1\CCCCN1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C10H11ClN4S/c11-10-13-5-8(16-10)6-15-4-2-1-3-9(15)14-7-12/h5H,1-4,6H2/b14-9+ |
| InChIKey | DITCUPKTSSXEOU-NTEUORMPSA-N |
| XLogP | 2.66 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.75 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide?
The IUPAC name of [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide (CID 20643132) is [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide.
What is the SMILES notation for [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide?
The canonical SMILES for [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide is N#C/N=C1\CCCCN1Cc1cnc(Cl)s1.
What is the InChIKey of [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide?
The InChIKey is DITCUPKTSSXEOU-NTEUORMPSA-N. The full InChI is InChI=1S/C10H11ClN4S/c11-10-13-5-8(16-10)6-15-4-2-1-3-9(15)14-7-12/h5H,1-4,6H2/b14-9+.
What are the key properties of [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide?
[1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide has a molecular weight of 254.75 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-chloro-1,3-thiazol-5-yl)methyl]piperidin-2-ylidene]cyanamide is sourced from PubChem (CID 20643132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).