C21H40N4O4 — CID 20643297
N-[[formyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)formamide (PubChem CID 20643297) has the molecular formula C21H40N4O4 and a molecular weight of 412.58 g/mol. Its IUPAC name is N-[[formyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)formamide.
| Compound Name | N-[[formyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 20643297 |
| Molecular Formula | C21H40N4O4 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | N-[[formyl-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)formamide |
| SMILES | CC1(C)CC(N(C=O)CN(C=O)C2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C21H40N4O4/c1-18(2)9-16(10-19(3,4)24(18)28)22(14-26)13-23(15-27)17-11-20(5,6)25(29)21(7,8)12-17/h14-17,28-29H,9-13H2,1-8H3 |
| InChIKey | KUMYZVPHPSFMDO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|