About 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane
4-methyl-1,2-bis(trifluoromethoxy)cyclohexane (PubChem CID 20643370) has the molecular formula C9H12F6O2
and a molecular weight of 266.18 g/mol. Its IUPAC name is 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane.
Molecular Properties
| Compound Name | 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane |
| PubChem CID | 20643370 |
| Molecular Formula | C9H12F6O2 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane |
| SMILES | CC1CCC(OC(F)(F)F)C(OC(F)(F)F)C1 |
| InChI | InChI=1S/C9H12F6O2/c1-5-2-3-6(16-8(10,11)12)7(4-5)17-9(13,14)15/h5-7H,2-4H2,1H3 |
| InChIKey | WSDFNSUTWJVTKC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane?
The IUPAC name of 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane (CID 20643370) is 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane.
What is the SMILES notation for 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane?
The canonical SMILES for 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane is CC1CCC(OC(F)(F)F)C(OC(F)(F)F)C1.
What is the InChIKey of 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane?
The InChIKey is WSDFNSUTWJVTKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F6O2/c1-5-2-3-6(16-8(10,11)12)7(4-5)17-9(13,14)15/h5-7H,2-4H2,1H3.
What are the key properties of 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane?
4-methyl-1,2-bis(trifluoromethoxy)cyclohexane has a molecular weight of 266.18 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,2-bis(trifluoromethoxy)cyclohexane is sourced from PubChem (CID 20643370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).