C17H12N2O11S3 — CID 20643390
2-[(E)-2-(6-methyl-4-sulfo-1,3-benzoxazol-2-yl)ethenyl]-1,3-benzoxazole-4,6-disulfonic acid (PubChem CID 20643390) has the molecular formula C17H12N2O11S3 and a molecular weight of 516.49 g/mol. Its IUPAC name is 2-[(E)-2-(6-methyl-4-sulfo-1,3-benzoxazol-2-yl)ethenyl]-1,3-benzoxazole-4,6-disulfonic acid.
| Compound Name | 2-[(E)-2-(6-methyl-4-sulfo-1,3-benzoxazol-2-yl)ethenyl]-1,3-benzoxazole-4,6-disulfonic acid |
|---|---|
| PubChem CID | 20643390 |
| Molecular Formula | C17H12N2O11S3 |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 515.96 |
| IUPAC Name | 2-[(E)-2-(6-methyl-4-sulfo-1,3-benzoxazol-2-yl)ethenyl]-1,3-benzoxazole-4,6-disulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c2nc(/C=C/c3nc4c(S(=O)(=O)O)cc(S(=O)(=O)O)cc4o3)oc2c1 |
| InChI | InChI=1S/C17H12N2O11S3/c1-8-4-10-16(12(5-8)32(23,24)25)18-14(29-10)2-3-15-19-17-11(30-15)6-9(31(20,21)22)7-13(17)33(26,27)28/h2-7H,1H3,(H,20,21,22)(H,23,24,25)(H,26,27,28)/b3-2+ |
| InChIKey | MXUZLOPQGGCERZ-NSCUHMNNSA-N |
| XLogP | 2.19 |
| TPSA | 215.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|