C17H12N2O8S2 — CID 20643391
2-[(E)-2-(6-methyl-1,3-benzoxazol-2-yl)ethenyl]-1,3-benzoxazole-4,6-disulfonic acid (PubChem CID 20643391) has the molecular formula C17H12N2O8S2 and a molecular weight of 436.42 g/mol. Its IUPAC name is 2-[(E)-2-(6-methyl-1,3-benzoxazol-2-yl)ethenyl]-1,3-benzoxazole-4,6-disulfonic acid.
| Compound Name | 2-[(E)-2-(6-methyl-1,3-benzoxazol-2-yl)ethenyl]-1,3-benzoxazole-4,6-disulfonic acid |
|---|---|
| PubChem CID | 20643391 |
| Molecular Formula | C17H12N2O8S2 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | 2-[(E)-2-(6-methyl-1,3-benzoxazol-2-yl)ethenyl]-1,3-benzoxazole-4,6-disulfonic acid |
| SMILES | Cc1ccc2nc(/C=C/c3nc4c(S(=O)(=O)O)cc(S(=O)(=O)O)cc4o3)oc2c1 |
| InChI | InChI=1S/C17H12N2O8S2/c1-9-2-3-11-12(6-9)26-15(18-11)4-5-16-19-17-13(27-16)7-10(28(20,21)22)8-14(17)29(23,24)25/h2-8H,1H3,(H,20,21,22)(H,23,24,25)/b5-4+ |
| InChIKey | SONTVEQQTYUVBF-SNAWJCMRSA-N |
| XLogP | 2.94 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|