C21H14N2O11S3 — CID 20643404
2-[4-(6-methyl-4-sulfo-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-4,6-disulfonic acid (PubChem CID 20643404) has the molecular formula C21H14N2O11S3 and a molecular weight of 566.55 g/mol. Its IUPAC name is 2-[4-(6-methyl-4-sulfo-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-4,6-disulfonic acid.
| Compound Name | 2-[4-(6-methyl-4-sulfo-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-4,6-disulfonic acid |
|---|---|
| PubChem CID | 20643404 |
| Molecular Formula | C21H14N2O11S3 |
| Molecular Weight | 566.55 g/mol |
| Exact Mass | 565.98 |
| IUPAC Name | 2-[4-(6-methyl-4-sulfo-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-4,6-disulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c2nc(-c3ccc(-c4nc5c(S(=O)(=O)O)cc(S(=O)(=O)O)cc5o4)cc3)oc2c1 |
| InChI | InChI=1S/C21H14N2O11S3/c1-10-6-14-18(16(7-10)36(27,28)29)22-20(33-14)11-2-4-12(5-3-11)21-23-19-15(34-21)8-13(35(24,25)26)9-17(19)37(30,31)32/h2-9H,1H3,(H,24,25,26)(H,27,28,29)(H,30,31,32) |
| InChIKey | VGVZOUVWNYKQTN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 215.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|