C21H14N2O8S2 — CID 20643407
2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-4,6-disulfonic acid (PubChem CID 20643407) has the molecular formula C21H14N2O8S2 and a molecular weight of 486.48 g/mol. Its IUPAC name is 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-4,6-disulfonic acid.
| Compound Name | 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-4,6-disulfonic acid |
|---|---|
| PubChem CID | 20643407 |
| Molecular Formula | C21H14N2O8S2 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-4,6-disulfonic acid |
| SMILES | Cc1ccc2nc(-c3ccc(-c4nc5c(S(=O)(=O)O)cc(S(=O)(=O)O)cc5o4)cc3)oc2c1 |
| InChI | InChI=1S/C21H14N2O8S2/c1-11-2-7-15-16(8-11)30-20(22-15)12-3-5-13(6-4-12)21-23-19-17(31-21)9-14(32(24,25)26)10-18(19)33(27,28)29/h2-10H,1H3,(H,24,25,26)(H,27,28,29) |
| InChIKey | OMKGHQQWDPGIKV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|