About 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid
2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid (PubChem CID 20643408) has the molecular formula C21H14N2O5S
and a molecular weight of 406.42 g/mol. Its IUPAC name is 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid.
Molecular Properties
| Compound Name | 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid |
| PubChem CID | 20643408 |
| Molecular Formula | C21H14N2O5S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid |
| SMILES | Cc1ccc2nc(-c3ccc(-c4nc5ccc(S(=O)(=O)O)cc5o4)cc3)oc2c1 |
| InChI | InChI=1S/C21H14N2O5S/c1-12-2-8-16-18(10-12)27-20(22-16)13-3-5-14(6-4-13)21-23-17-9-7-15(29(24,25)26)11-19(17)28-21/h2-11H,1H3,(H,24,25,26) |
| InChIKey | CHUZLDJQFCHHTC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid?
The IUPAC name of 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid (CID 20643408) is 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid.
What is the SMILES notation for 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid?
The canonical SMILES for 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid is Cc1ccc2nc(-c3ccc(-c4nc5ccc(S(=O)(=O)O)cc5o4)cc3)oc2c1.
What is the InChIKey of 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid?
The InChIKey is CHUZLDJQFCHHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N2O5S/c1-12-2-8-16-18(10-12)27-20(22-16)13-3-5-14(6-4-13)21-23-17-9-7-15(29(24,25)26)11-19(17)28-21/h2-11H,1H3,(H,24,25,26).
What are the key properties of 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid?
2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid has a molecular weight of 406.42 g/mol, XLogP of 4.86, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-benzoxazole-6-sulfonic acid is sourced from PubChem (CID 20643408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).