C57H56N4O6 — CID 20643514
9H-fluoren-9-ylmethyl N-[1-[[1-[4-(hydroxymethyl)anilino]-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 20643514) has the molecular formula C57H56N4O6 and a molecular weight of 893.10 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[1-[[1-[4-(hydroxymethyl)anilino]-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[1-[[1-[4-(hydroxymethyl)anilino]-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 20643514 |
| Molecular Formula | C57H56N4O6 |
| Molecular Weight | 893.10 g/mol |
| Exact Mass | 892.42 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[1-[[1-[4-(hydroxymethyl)anilino]-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | COc1ccc(C(NCCCCC(NC(=O)C(Cc2ccccc2)NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)Nc2ccc(CO)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C57H56N4O6/c1-66-46-34-30-44(31-35-46)57(42-19-7-3-8-20-42,43-21-9-4-10-22-43)58-36-16-15-27-52(54(63)59-45-32-28-41(38-62)29-33-45)60-55(64)53(37-40-17-5-2-6-18-40)61-56(65)67-39-51-49-25-13-11-23-47(49)48-24-12-14-26-50(48)51/h2-14,17-26,28-35,51-53,58,62H,15-16,27,36-39H2,1H3,(H,59,63)(H,60,64)(H,61,65) |
| InChIKey | QCCBVQOZKGLFBU-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.10 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|