About 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one
6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one (PubChem CID 20643690) has the molecular formula C8H8O3S
and a molecular weight of 184.22 g/mol. Its IUPAC name is 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one |
| PubChem CID | 20643690 |
| Molecular Formula | C8H8O3S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one |
| SMILES | C=C1C=C(S(C)(=O)=O)C=CC1=O |
| InChI | InChI=1S/C8H8O3S/c1-6-5-7(12(2,10)11)3-4-8(6)9/h3-5H,1H2,2H3 |
| InChIKey | JNWQECFBMTZYHQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one?
The IUPAC name of 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one (CID 20643690) is 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one is C=C1C=C(S(C)(=O)=O)C=CC1=O.
What is the InChIKey of 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one?
The InChIKey is JNWQECFBMTZYHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3S/c1-6-5-7(12(2,10)11)3-4-8(6)9/h3-5H,1H2,2H3.
What are the key properties of 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one?
6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one has a molecular weight of 184.22 g/mol, XLogP of 0.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidene-4-methylsulfonylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 20643690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).