About [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate
[3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 20643745) has the molecular formula C14H22ClNO5
and a molecular weight of 319.79 g/mol. Its IUPAC name is [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate |
| PubChem CID | 20643745 |
| Molecular Formula | C14H22ClNO5 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(=O)NCCC(=O)OC(C)(C)CCl |
| InChI | InChI=1S/C14H22ClNO5/c1-10(2)13(19)20-8-6-11(17)16-7-5-12(18)21-14(3,4)9-15/h1,5-9H2,2-4H3,(H,16,17) |
| InChIKey | QQFZJJALRDUADM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate?
The IUPAC name of [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate (CID 20643745) is [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate.
What is the SMILES notation for [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate?
The canonical SMILES for [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate is C=C(C)C(=O)OCCC(=O)NCCC(=O)OC(C)(C)CCl.
What is the InChIKey of [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate?
The InChIKey is QQFZJJALRDUADM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22ClNO5/c1-10(2)13(19)20-8-6-11(17)16-7-5-12(18)21-14(3,4)9-15/h1,5-9H2,2-4H3,(H,16,17).
What are the key properties of [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate?
[3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate has a molecular weight of 319.79 g/mol, XLogP of 1.56, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[3-(1-chloro-2-methylpropan-2-yl)oxy-3-oxopropyl]amino]-3-oxopropyl] 2-methylprop-2-enoate is sourced from PubChem (CID 20643745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).