C34H31N2O3S+ — CID 20644189
(6Z)-6-[[(7E)-7-[(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-7-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole (PubChem CID 20644189) has the molecular formula C34H31N2O3S+ and a molecular weight of 547.70 g/mol. Its IUPAC name is (6Z)-6-[[(7E)-7-[(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-7-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole.
| Compound Name | (6Z)-6-[[(7E)-7-[(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-7-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 20644189 |
| Molecular Formula | C34H31N2O3S+ |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | (6Z)-6-[[(7E)-7-[(1-ethylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]-4,4a,5,6-tetrahydro-3H-naphthalen-2-yl]methylidene]-7-methyl-[1,3]dioxolo[4,5-f][1,3]benzothiazole |
| SMILES | CC[n+]1c(/C=C2/C=C3C=C(/C=C4\Sc5cc6c(cc5N4C)OCO6)CCC3CC2)oc2ccc3ccccc3c21 |
| InChI | InChI=1S/C34H31N2O3S/c1-3-36-32(39-28-13-12-24-6-4-5-7-26(24)34(28)36)16-21-8-10-23-11-9-22(15-25(23)14-21)17-33-35(2)27-18-29-30(38-20-37-29)19-31(27)40-33/h4-7,12-19,23H,3,8-11,20H2,1-2H3/q+1 |
| InChIKey | RVQLYWYPNJBHJE-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 38.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|